Addition of tin(II) chloride to Pd2(Ph2PCH2PPh2)2CI2. The crystal and molecular structure of Pd2(Ph2PCH2PPh2)2(SnCl3)Cl

Inorganica Chimica Acta

Volumn 32, Issue C, 1979, Pages 193-198

  Olmstead, Marilyn M ^a   Benner, Linda S ^a   Hope, Hakon ^a   Balch, Alan L ^a  

^a UNIVERSITY OF CALIFORNIA   (United States)

Author keywords

[No Author keywords available]

Indexed keywords

EID: 0000868186     PISSN: 00201693     EISSN: None     Source Type: Journal    
DOI: 10.1016/S0020-1693(00)91660-8     Document Type: Article

References (11)

1. Crystal structure of ?-allyl(triphenylphosphine)palladium?trichlorotin
2. The crystal structure and some reactions of bis(cyclo-octa-1,5-diene)-iridiumtrichlorotin
3. Crystal and molecular structure of tri-�-chloro-pentacarbonyl(trichlorostannyl)diruthenium